Name: H-(Gly)3-Lys(N3)-OH HCl
Brand: BOC Sciences
Rating: 5 (1 reviews)

Synonyms

Triglycyl-N-epsilon-azido lysine hydrochloride; (2S)-2-{2-[2-(2-Azaniumylacetamido)acetamido]acetamido}-6-azidohexanoic acid chloride; H-(Gly)3-Lys(N3).HCl; H-(Gly)3-Lys(N3)-OH.HCl; Triglycyl-Ne-azido-L-lysine hydrochloride; Triglycyl-epsilon-azido-L-lysine hydrochloride; (2S)-2-{2-[2-(2-Aminoacetamido)acetamido]acetamido}-6-azidohexanoic acid hydrochloride; H-Gly-Gly-Gly-Lys(N3) HCl; H-(Gly)3-Lys(N3)-OH hydrochloride; H-Gly-Gly-Gly-Nle(N3)-OH.HCl; Glycyl-glycyl-glycyl-6-azido-L-norleucine hydrochloride; N6-Diazo-N2-glycylglycylglycyl-L-lysine hydrochloride

IUPAC Name

(2S)-2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]-6-azidohexanoic acid;hydrochloride

Canonical SMILES

C(CCN=[N+]=[N-])C[C@@H](C(=O)O)NC(=O)CNC(=O)CNC(=O)CN.Cl

InChI

InChI=1S/C12H21N7O5.ClH/c13-5-9(20)15-6-10(21)16-7-11(22)18-8(12(23)24)3-1-2-4-17-19-14;/h8H,1-7,13H2,(H,15,20)(H,16,21)(H,18,22)(H,23,24);1H/t8-;/m0./s1

InChIKey

FHWDRASZJQHVLA-QRPNPIFTSA-N

Sequence

Gly-Gly-Gly-Lys(N3).HCl

Appearance

White powder

Storage

Store at 2-8 °C

H-(Gly)3-Lys(N3)-OH hydrochloride is a versatile chemical compound used in various bioscientific applications. Here are some of the key applications of H-(Gly)3-Lys(N3)-OH hydrochloride:

Peptide Synthesis: H-(Gly)3-Lys(N3)-OH hydrochloride is often utilized in the synthesis of complex peptides. The azide-functional group allows for further chemical modifications through click chemistry, enhancing the versatility of synthesized peptides. This compound is crucial for producing custom peptides for research and therapeutic purposes.

Drug Delivery Systems: The molecule can be incorporated into drug delivery systems to enhance the targeting and release properties of therapeutic agents. By using its azide group, researchers can attach various ligands or drug molecules through bioorthogonal chemistry. This leads to more efficient and precise drug delivery, improving treatment efficacy.

Bioconjugation: H-(Gly)3-Lys(N3)-OH hydrochloride is frequently used in bioconjugation techniques to link biomolecules such as proteins, DNA, and other peptides. The compound’s unique chemical properties facilitate the formation of stable conjugates. These conjugates are fundamental in diagnostic assays, imaging, and targeted therapies.

Tissue Engineering: This compound finds applications in tissue engineering, where it is used to functionalize scaffolds and biomaterials. The azide group can be employed to attach growth factors, cell-adhesion molecules, or other bioactive substances. This modification improves cell attachment, proliferation, and differentiation, fostering the development of engineered tissues.