Name: Mal-NH-ethyl-SS-propionic acid
Brand: BOC Sciences
Rating: 5 (1 reviews)

Synonyms

3-((2-(3-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)propanamido)ethyl)disulfanyl)propanoic acid

IUPAC Name

Canonical SMILES

C1=CC(=O)N(C1=O)CCC(=O)NCCSSCCC(=O)O

InChI

InChI=1S/C12H16N2O5S2/c15-9(3-6-14-10(16)1-2-11(14)17)13-5-8-21-20-7-4-12(18)19/h1-2H,3-8H2,(H,13,15)(H,18,19)

InChIKey

MQYOVZAKKXDVHK-UHFFFAOYSA-N

Solubility

10 mm in DMSO

Appearance

Solid

Shelf Life

0-4°C for short term (days to weeks), or -20°C for long term (months).

Shipping

Room temperature, or blue ice upon request.

Storage

Store at -5°C,keep in dry and avoid sunlight.

Form

Solid

Mal-NH-ethyl-SS-propionic acid is a chemical compound often employed in various biochemical and pharmaceutical applications due to its unique properties. Here are some key applications of Mal-NH-ethyl-SS-propionic acid:

Bioconjugation: Mal-NH-ethyl-SS-propionic acid is frequently used in bioconjugation procedures to link biomolecules such as proteins and antibodies to other chemical entities. The presence of a maleimide group allows for the selective and stable covalent bonding to thiol groups on biomolecules. This application is crucial for developing targeted drug delivery systems and diagnostic tools.

Drug Delivery: This compound can be used to enhance the design of drug delivery systems by facilitating the attachment of therapeutic agents to carriers such as nanoparticles. By using Mal-NH-ethyl-SS-propionic acid as a linking agent, researchers can create more stable and effective delivery vehicles. This ensures the precise release and targeting of drugs to specific tissues or cells in the body.

Crosslinking in Polymeric Systems: Mal-NH-ethyl-SS-propionic acid acts as a crosslinker in the formation of polymer networks, which are used in various biomedical applications including hydrogels and scaffolds. By modifying polymer ends with this compound, crosslinking can enhance material strength and functional properties. This is particularly useful in creating advanced materials for tissue engineering and controlled drug release applications.

Protein Modification: In protein chemistry, Mal-NH-ethyl-SS-propionic acid serves as a reagent for the specific modification of cysteine residues. This allows scientists to introduce new functional groups or labels onto proteins without affecting their activity. Such modifications are critical in studying protein structure, function, and interactions, providing insights into cellular processes and potential intervention strategies.