Name: N-(35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacontyl)-4-formylbenzamide
Brand: BOC Sciences
Rating: 5 (1 reviews)

Size

Price

Stock

Quantity

$--

In stock

Synonyms

Ald-Ph-PEG11-amine; Ald-Ph-amido-C2-PEG11-amine; CHO-Ph-PEG11-amine; CHO-Ph-CONH-PEG11-amine; Ald-Ph-PEG11-NH2; Benzamide, N-(35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacont-1-yl)-4-formyl-

IUPAC Name

N-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-4-formylbenzamide

Canonical SMILES

C1=CC(=CC=C1C=O)C(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN

InChI

InChI=1S/C32H56N2O13/c33-5-7-37-9-11-39-13-15-41-17-19-43-21-23-45-25-27-47-28-26-46-24-22-44-20-18-42-16-14-40-12-10-38-8-6-34-32(36)31-3-1-30(29-35)2-4-31/h1-4,29H,5-28,33H2,(H,34,36)

InChIKey

CAXZOLSIKSTMBB-UHFFFAOYSA-N

Density

1.137±0.06 g/cm3 (Predicted)

Solubility

Soluble in DMSO

Appearance

Soild powder

Shipping

-20°C (International: -20°C)

Storage

Store at 2-8°C

Boiling Point

755.2±60.0°C (Predicted)

N-(35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacontyl)-4-formylbenzamide is a complex chemical compound characterized by a long, flexible polyether chain (undecaoxapentatriacontyl) attached to a formylbenzamide moiety. The presence of the polyether group allows the compound to exhibit unique physicochemical properties, such as enhanced solubility, stability, and flexibility. This structure makes it highly versatile for applications in fields like drug delivery, enzyme inhibition, and targeted therapies. The combination of these functional groups can provide improved biological activity and selectivity in therapeutic applications.

One of the key applications of N-(35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacontyl)-4-formylbenzamide lies in drug delivery systems. The long polyether chain imparts solubility and permeability advantages, enabling better membrane penetration and cellular uptake. When conjugated with other bioactive molecules, this compound can serve as an efficient linker in prodrug formulations. By attaching to specific drugs, it can enhance the targeting ability of the drug, facilitating its release in specific tissues or tumors. This targeted release minimizes the systemic side effects of the drug and increases its therapeutic effectiveness, particularly for localized treatment of diseases such as cancer or chronic inflammatory disorders.

The formylbenzamide component of N-(35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacontyl)-4-formylbenzamide plays a crucial role in modulating cellular pathways involved in diseases like cancer. The compound may interact with key enzymes, receptors, or signaling molecules that are dysregulated in cancer cells. The polyether chain’s flexibility and the formyl group’s ability to engage with cellular targets allow for selective inhibition of cancer cell growth, proliferation, or migration. This makes the compound a promising candidate for developing targeted anticancer therapies, particularly for solid tumors that are less responsive to traditional treatments.

Another important application of N-(35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacontyl)-4-formylbenzamide is in enzyme inhibition, particularly for enzymes involved in metabolic disorders or inflammatory diseases. The compound’s long polyether chain could help it to interact with enzymes more selectively, improving its ability to modulate their activity. For example, it may inhibit proteases, kinases, or phosphatases that contribute to disease progression. By acting as a potent enzyme inhibitor, this compound can be applied in the treatment of diseases where dysregulated enzyme activity plays a central role, such as autoimmune conditions, metabolic disorders, or neurodegenerative diseases.

In addition to its potential in drug delivery and enzyme inhibition, N-(35-amino-3,6,9,12,15,18,21,24,27,30,33-undecaoxapentatriacontyl)-4-formylbenzamide is also valuable in high-throughput screening (HTS) and drug discovery. Due to its unique structure, the compound can be used as a lead molecule to screen for potential interactions with target proteins or biological pathways. The polyether chain can provide a distinct binding profile, which is useful for identifying novel drug targets. Furthermore, researchers can modify the compound to explore structure-activity relationships, enabling the design of more effective and selective drugs for various diseases. This property makes it an indispensable tool in modern drug discovery and development.